C27H25ClN4O4S — CID 6173269
(E)-N-[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]-3-(4-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 6173269) has the molecular formula C27H25ClN4O4S and a molecular weight of 537.04 g/mol. Its IUPAC name is (E)-N-[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]-3-(4-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]-3-(4-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 6173269 |
| Molecular Formula | C27H25ClN4O4S |
| Molecular Weight | 537.04 g/mol |
| Exact Mass | 536.13 |
| IUPAC Name | (E)-N-[2-[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-3-yl]ethyl]-3-(4-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)N(CCc1csc2nc(-c3ccc(Cl)cc3)cn12)CC1CCCO1 |
| InChI | InChI=1S/C27H25ClN4O4S/c28-21-8-6-20(7-9-21)25-17-31-23(18-37-27(31)29-25)13-14-30(16-24-2-1-15-36-24)26(33)12-5-19-3-10-22(11-4-19)32(34)35/h3-12,17-18,24H,1-2,13-16H2/b12-5+ |
| InChIKey | WLWVCNNEGIOECE-LFYBBSHMSA-N |
| XLogP | 5.89 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.04 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|