methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate

C17H10F6O3S — CID 617818

IUPACmethyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate
SMILESCOC(=O)c1ccccc1SC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1
InChIInChI=1S/C17H10F6O3S/c1-26-14(24)12-4-2-3-5-13(12)27-15(25)9-6-10(16(18,19)20)8-11(7-9)17(21,22)23/h2-8H,1H3
InChIKeyUITIUQKTRHTXQI-UHFFFAOYSA-N
MW408.32 g/mol
LogP5.44
Rot. Bonds3

About methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate

methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate (PubChem CID 617818) has the molecular formula C17H10F6O3S and a molecular weight of 408.32 g/mol. Its IUPAC name is methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate.

Molecular Properties

Compound Namemethyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate
PubChem CID617818
Molecular FormulaC17H10F6O3S
Molecular Weight408.32 g/mol
Exact Mass408.03
IUPAC Namemethyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate
SMILESCOC(=O)c1ccccc1SC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1
InChIInChI=1S/C17H10F6O3S/c1-26-14(24)12-4-2-3-5-13(12)27-15(25)9-6-10(16(18,19)20)8-11(7-9)17(21,22)23/h2-8H,1H3
InChIKeyUITIUQKTRHTXQI-UHFFFAOYSA-N
XLogP5.44
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500408.32
LogP ≤ 55.44
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'thioester', 'substructure': 'N/A'}

Analyze methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate?
The IUPAC name of methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate (CID 617818) is methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate.
What is the SMILES notation for methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate?
The canonical SMILES for methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate is COC(=O)c1ccccc1SC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1.
What is the InChIKey of methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate?
The InChIKey is UITIUQKTRHTXQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H10F6O3S/c1-26-14(24)12-4-2-3-5-13(12)27-15(25)9-6-10(16(18,19)20)8-11(7-9)17(21,22)23/h2-8H,1H3.
What are the key properties of methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate?
methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate has a molecular weight of 408.32 g/mol, XLogP of 5.44, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate is sourced from PubChem (CID 617818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).