C17H10F6O3S — CID 617818
methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate (PubChem CID 617818) has the molecular formula C17H10F6O3S and a molecular weight of 408.32 g/mol. Its IUPAC name is methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate.
| Compound Name | methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate |
|---|---|
| PubChem CID | 617818 |
| Molecular Formula | C17H10F6O3S |
| Molecular Weight | 408.32 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | methyl 2-[3,5-bis(trifluoromethyl)benzoyl]sulfanylbenzoate |
| SMILES | COC(=O)c1ccccc1SC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H10F6O3S/c1-26-14(24)12-4-2-3-5-13(12)27-15(25)9-6-10(16(18,19)20)8-11(7-9)17(21,22)23/h2-8H,1H3 |
| InChIKey | UITIUQKTRHTXQI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.32 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|