C12H7N3O4S — CID 618279
N-(1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide (PubChem CID 618279) has the molecular formula C12H7N3O4S and a molecular weight of 289.27 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 618279 |
| Molecular Formula | C12H7N3O4S |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1ccc([N+](=O)[O-])o1 |
| InChI | InChI=1S/C12H7N3O4S/c16-11(8-5-6-10(19-8)15(17)18)14-12-13-7-3-1-2-4-9(7)20-12/h1-6H,(H,13,14,16) |
| InChIKey | INEMNYHCDSBKGP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|