C13H9N3O5S — CID 952238
N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide (PubChem CID 952238) has the molecular formula C13H9N3O5S and a molecular weight of 319.30 g/mol. Its IUPAC name is N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide.
| Compound Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide |
|---|---|
| PubChem CID | 952238 |
| Molecular Formula | C13H9N3O5S |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-(6-methoxy-1,3-benzothiazol-2-yl)-5-nitrofuran-2-carboxamide |
| SMILES | COc1ccc2nc(NC(=O)c3ccc([N+](=O)[O-])o3)sc2c1 |
| InChI | InChI=1S/C13H9N3O5S/c1-20-7-2-3-8-10(6-7)22-13(14-8)15-12(17)9-4-5-11(21-9)16(18)19/h2-6H,1H3,(H,14,15,17) |
| InChIKey | GWUVRBRWNNWQJC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|