C15H13N3O4 — CID 6182984
methyl 2-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]indol-1-yl]acetate (PubChem CID 6182984) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is methyl 2-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]indol-1-yl]acetate.
| Compound Name | methyl 2-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]indol-1-yl]acetate |
|---|---|
| PubChem CID | 6182984 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | methyl 2-[3-[(E)-(2,5-dioxoimidazolidin-4-ylidene)methyl]indol-1-yl]acetate |
| SMILES | COC(=O)Cn1cc(/C=C2/NC(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C15H13N3O4/c1-22-13(19)8-18-7-9(10-4-2-3-5-12(10)18)6-11-14(20)17-15(21)16-11/h2-7H,8H2,1H3,(H2,16,17,20,21)/b11-6+ |
| InChIKey | WUDSGFIAKURCIL-IZZDOVSWSA-N |
| XLogP | 0.99 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|