C16H21ClN4O4 — CID 6183371
N'-[(Z)-[4-(5-chloro-2-methylanilino)-4-oxobutan-2-ylidene]amino]-N-(2-methoxyethyl)oxamide (PubChem CID 6183371) has the molecular formula C16H21ClN4O4 and a molecular weight of 368.82 g/mol. Its IUPAC name is N'-[(Z)-[4-(5-chloro-2-methylanilino)-4-oxobutan-2-ylidene]amino]-N-(2-methoxyethyl)oxamide.
| Compound Name | N'-[(Z)-[4-(5-chloro-2-methylanilino)-4-oxobutan-2-ylidene]amino]-N-(2-methoxyethyl)oxamide |
|---|---|
| PubChem CID | 6183371 |
| Molecular Formula | C16H21ClN4O4 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N'-[(Z)-[4-(5-chloro-2-methylanilino)-4-oxobutan-2-ylidene]amino]-N-(2-methoxyethyl)oxamide |
| SMILES | COCCNC(=O)C(=O)N/N=C(/C)CC(=O)Nc1cc(Cl)ccc1C |
| InChI | InChI=1S/C16H21ClN4O4/c1-10-4-5-12(17)9-13(10)19-14(22)8-11(2)20-21-16(24)15(23)18-6-7-25-3/h4-5,9H,6-8H2,1-3H3,(H,18,23)(H,19,22)(H,21,24)/b20-11- |
| InChIKey | YCHVDTJJGMAWEV-JAIQZWGSSA-N |
| XLogP | 1.23 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|