C23H19N3O2 — CID 6184004
(E)-3-[3-(benzotriazol-1-ylmethyl)-4-methoxyphenyl]-1-phenylprop-2-en-1-one (PubChem CID 6184004) has the molecular formula C23H19N3O2 and a molecular weight of 369.42 g/mol. Its IUPAC name is (E)-3-[3-(benzotriazol-1-ylmethyl)-4-methoxyphenyl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[3-(benzotriazol-1-ylmethyl)-4-methoxyphenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 6184004 |
| Molecular Formula | C23H19N3O2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | (E)-3-[3-(benzotriazol-1-ylmethyl)-4-methoxyphenyl]-1-phenylprop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccccc2)cc1Cn1nnc2ccccc21 |
| InChI | InChI=1S/C23H19N3O2/c1-28-23-14-12-17(11-13-22(27)18-7-3-2-4-8-18)15-19(23)16-26-21-10-6-5-9-20(21)24-25-26/h2-15H,16H2,1H3/b13-11+ |
| InChIKey | TWOMASWBGWYCSC-ACCUITESSA-N |
| XLogP | 4.38 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|