C19H16N2O4S2 — CID 618695
N-(5,5-dioxo-6H-benzo[c][1,2]benzothiazin-9-yl)-4-methylbenzenesulfonamide (PubChem CID 618695) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-(5,5-dioxo-6H-benzo[c][1,2]benzothiazin-9-yl)-4-methylbenzenesulfonamide.
| Compound Name | N-(5,5-dioxo-6H-benzo[c][1,2]benzothiazin-9-yl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 618695 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-(5,5-dioxo-6H-benzo[c][1,2]benzothiazin-9-yl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)-c2ccccc2S(=O)(=O)N3)cc1 |
| InChI | InChI=1S/C19H16N2O4S2/c1-13-6-9-15(10-7-13)26(22,23)20-14-8-11-18-17(12-14)16-4-2-3-5-19(16)27(24,25)21-18/h2-12,20-21H,1H3 |
| InChIKey | KIAIWGCNEMTYEN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|