C11H8Cl2N4O2 — CID 618703
N-(2,6-dichlorophenyl)-4-formamido-1H-imidazole-5-carboxamide (PubChem CID 618703) has the molecular formula C11H8Cl2N4O2 and a molecular weight of 299.12 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4-formamido-1H-imidazole-5-carboxamide.
| Compound Name | N-(2,6-dichlorophenyl)-4-formamido-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 618703 |
| Molecular Formula | C11H8Cl2N4O2 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 298.00 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4-formamido-1H-imidazole-5-carboxamide |
| SMILES | O=CNc1nc[nH]c1C(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C11H8Cl2N4O2/c12-6-2-1-3-7(13)8(6)17-11(19)9-10(16-5-18)15-4-14-9/h1-5H,(H,14,15)(H,16,18)(H,17,19) |
| InChIKey | LOANDTGYNKXDPE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|