C27H27N5O3 — CID 6188664
(4E)-5-(4-ethylphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione (PubChem CID 6188664) has the molecular formula C27H27N5O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is (4E)-5-(4-ethylphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-(4-ethylphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6188664 |
| Molecular Formula | C27H27N5O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | (4E)-5-(4-ethylphenyl)-4-[hydroxy-(2-methylimidazo[1,2-a]pyridin-3-yl)methylidene]-1-(3-imidazol-1-ylpropyl)pyrrolidine-2,3-dione |
| SMILES | CCc1ccc(C2/C(=C(\O)c3c(C)nc4ccccn34)C(=O)C(=O)N2CCCn2ccnc2)cc1 |
| InChI | InChI=1S/C27H27N5O3/c1-3-19-8-10-20(11-9-19)24-22(25(33)23-18(2)29-21-7-4-5-14-31(21)23)26(34)27(35)32(24)15-6-13-30-16-12-28-17-30/h4-5,7-12,14,16-17,24,33H,3,6,13,15H2,1-2H3/b25-22+ |
| InChIKey | OQJYXKOHHCTQGJ-YYDJUVGSSA-N |
| XLogP | 3.91 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|