C36H44N2O5 — CID 6191896
(4E)-1-[2-(diethylamino)ethyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 6191896) has the molecular formula C36H44N2O5 and a molecular weight of 584.76 g/mol. Its IUPAC name is (4E)-1-[2-(diethylamino)ethyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-[2-(diethylamino)ethyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6191896 |
| Molecular Formula | C36H44N2O5 |
| Molecular Weight | 584.76 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | (4E)-1-[2-(diethylamino)ethyl]-4-[hydroxy-[4-[(2-methylphenyl)methoxy]phenyl]methylidene]-5-(4-pentoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCCCOc1ccc(C2/C(=C(\O)c3ccc(OCc4ccccc4C)cc3)C(=O)C(=O)N2CCN(CC)CC)cc1 |
| InChI | InChI=1S/C36H44N2O5/c1-5-8-11-24-42-30-18-14-27(15-19-30)33-32(35(40)36(41)38(33)23-22-37(6-2)7-3)34(39)28-16-20-31(21-17-28)43-25-29-13-10-9-12-26(29)4/h9-10,12-21,33,39H,5-8,11,22-25H2,1-4H3/b34-32+ |
| InChIKey | QPKLQWCKQLBSFB-NWBJSICCSA-N |
| XLogP | 6.91 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.76 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|