C25H48I2N2 — CID 6192
N~3~,N~3~,N~3~,N~17~,N~17~,N~17~-Hexamethylandrostane-3,17-bis(aminium) diiodide (PubChem CID 6192) has the molecular formula C25H48I2N2 and a molecular weight of 630.50 g/mol. Its IUPAC name is [(3R,5S,8R,10S,13S,17R)-10,13-dimethyl-3-(trimethylazaniumyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-trimethylazanium diiodide.
| Compound Name | N~3~,N~3~,N~3~,N~17~,N~17~,N~17~-Hexamethylandrostane-3,17-bis(aminium) diiodide |
|---|---|
| PubChem CID | 6192 |
| Molecular Formula | C25H48I2N2 |
| Molecular Weight | 630.50 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | [(3R,5S,8R,10S,13S,17R)-10,13-dimethyl-3-(trimethylazaniumyl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-trimethylazanium diiodide |
| SMILES | C[C@]12CC[C@H](C[C@@H]1CC[C@@H]3C2CC[C@]4(C3CC[C@H]4[N+](C)(C)C)C)[N+](C)(C)C.[I-].[I-] |
| InChIKey | ZVIZSIIUKWNKPJ-VGFHXRMQSA-L |
| XLogP | N/A |
| TPSA | 0.00 Ų |
| H-Bond Donors | 0 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | 570 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|