C32H29N5O5S — CID 6194946
(4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 6194946) has the molecular formula C32H29N5O5S and a molecular weight of 595.68 g/mol. Its IUPAC name is (4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 6194946 |
| Molecular Formula | C32H29N5O5S |
| Molecular Weight | 595.68 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | (4E)-4-[(3,8-dimethylimidazo[1,2-a]pyridin-2-yl)-hydroxymethylidene]-5-(3-ethoxy-4-phenylmethoxyphenyl)-1-(5-methyl-1,3,4-thiadiazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(\O)c3nc4c(C)cccn4c3C)C(=O)C(=O)N2c2nnc(C)s2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H29N5O5S/c1-5-41-24-16-22(13-14-23(24)42-17-21-11-7-6-8-12-21)27-25(29(39)31(40)37(27)32-35-34-20(4)43-32)28(38)26-19(3)36-15-9-10-18(2)30(36)33-26/h6-16,27,38H,5,17H2,1-4H3/b28-25+ |
| InChIKey | KNGCTUUISTXSQY-AZPGRJICSA-N |
| XLogP | 5.72 |
| TPSA | 119.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.68 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|