C34H24ClN5O2S — CID 6196169
(5'Z)-5'-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one (PubChem CID 6196169) has the molecular formula C34H24ClN5O2S and a molecular weight of 602.12 g/mol. Its IUPAC name is (5'Z)-5'-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one.
| Compound Name | (5'Z)-5'-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
|---|---|
| PubChem CID | 6196169 |
| Molecular Formula | C34H24ClN5O2S |
| Molecular Weight | 602.12 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | (5'Z)-5'-[[3-(4-chlorophenyl)-1-phenylpyrazol-4-yl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
| SMILES | O=C1NC2(Oc3ccccc3C3CC(c4ccccc4)=NN32)/C(=C/c2cn(-c3ccccc3)nc2-c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C34H24ClN5O2S/c35-25-17-15-23(16-18-25)32-24(21-39(38-32)26-11-5-2-6-12-26)19-31-34(36-33(41)43-31)40-29(27-13-7-8-14-30(27)42-34)20-28(37-40)22-9-3-1-4-10-22/h1-19,21,29H,20H2,(H,36,41)/b31-19- |
| InChIKey | SGIOVFIXRSKOJB-DXJNIWACSA-N |
| XLogP | 7.89 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.12 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|