C40H29N5O2S — CID 3444826
5'-[[4-(3,5-diphenylpyrazol-1-yl)phenyl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one (PubChem CID 3444826) has the molecular formula C40H29N5O2S and a molecular weight of 643.77 g/mol. Its IUPAC name is 5'-[[4-(3,5-diphenylpyrazol-1-yl)phenyl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one.
| Compound Name | 5'-[[4-(3,5-diphenylpyrazol-1-yl)phenyl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
|---|---|
| PubChem CID | 3444826 |
| Molecular Formula | C40H29N5O2S |
| Molecular Weight | 643.77 g/mol |
| Exact Mass | 643.20 |
| IUPAC Name | 5'-[[4-(3,5-diphenylpyrazol-1-yl)phenyl]methylidene]-2-phenylspiro[1,10b-dihydropyrazolo[1,5-c][1,3]benzoxazine-5,4'-1,3-thiazolidine]-2'-one |
| SMILES | O=C1NC2(Oc3ccccc3C3CC(c4ccccc4)=NN32)C(=Cc2ccc(-n3nc(-c4ccccc4)cc3-c3ccccc3)cc2)S1 |
| InChI | InChI=1S/C40H29N5O2S/c46-39-41-40(45-36(32-18-10-11-19-37(32)47-40)26-34(43-45)29-14-6-2-7-15-29)38(48-39)24-27-20-22-31(23-21-27)44-35(30-16-8-3-9-17-30)25-33(42-44)28-12-4-1-5-13-28/h1-25,36H,26H2,(H,41,46) |
| InChIKey | ZJANEVHNQQSIMH-UHFFFAOYSA-N |
| XLogP | 8.90 |
| TPSA | 71.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.77 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|