C14H14BrNO2 — CID 62001329
[5-bromo-2-(2,5-dimethylphenoxy)-3-pyridinyl]methanol (PubChem CID 62001329) has the molecular formula C14H14BrNO2 and a molecular weight of 308.18 g/mol. Its IUPAC name is [5-bromo-2-(2,5-dimethylphenoxy)-3-pyridinyl]methanol.
| Compound Name | [5-bromo-2-(2,5-dimethylphenoxy)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 62001329 |
| Molecular Formula | C14H14BrNO2 |
| Molecular Weight | 308.18 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | [5-bromo-2-(2,5-dimethylphenoxy)-3-pyridinyl]methanol |
| SMILES | Cc1ccc(C)c(Oc2ncc(Br)cc2CO)c1 |
| InChI | InChI=1S/C14H14BrNO2/c1-9-3-4-10(2)13(5-9)18-14-11(8-17)6-12(15)7-16-14/h3-7,17H,8H2,1-2H3 |
| InChIKey | CCCULFMTSQIFIM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.18 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |