C15H26N2 — CID 62001526
1-N-(4-ethylphenyl)-1-N,2-dimethylpentane-1,2-diamine (PubChem CID 62001526) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-N-(4-ethylphenyl)-1-N,2-dimethylpentane-1,2-diamine.
| Compound Name | 1-N-(4-ethylphenyl)-1-N,2-dimethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 62001526 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-N-(4-ethylphenyl)-1-N,2-dimethylpentane-1,2-diamine |
| SMILES | CCCC(C)(N)CN(C)c1ccc(CC)cc1 |
| InChI | InChI=1S/C15H26N2/c1-5-11-15(3,16)12-17(4)14-9-7-13(6-2)8-10-14/h7-10H,5-6,11-12,16H2,1-4H3 |
| InChIKey | OKCCWAMQEJCPNI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|