C15H23NO2 — CID 65248225
4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid (PubChem CID 65248225) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid.
| Compound Name | 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid |
|---|---|
| PubChem CID | 65248225 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid |
| SMILES | CCc1ccc(N(C)CCC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C15H23NO2/c1-5-12-6-8-13(9-7-12)16(4)11-10-15(2,3)14(17)18/h6-9H,5,10-11H2,1-4H3,(H,17,18) |
| InChIKey | KDAQCFUGHXEQHN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|