4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid

C15H23NO2 — CID 65248225

IUPAC4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid
SMILESCCc1ccc(N(C)CCC(C)(C)C(=O)O)cc1
InChIInChI=1S/C15H23NO2/c1-5-12-6-8-13(9-7-12)16(4)11-10-15(2,3)14(17)18/h6-9H,5,10-11H2,1-4H3,(H,17,18)
InChIKeyKDAQCFUGHXEQHN-UHFFFAOYSA-N
MW249.35 g/mol
LogP3.19
Rot. Bonds6

About 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid

4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid (PubChem CID 65248225) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid.

Molecular Properties

Compound Name4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid
PubChem CID65248225
Molecular FormulaC15H23NO2
Molecular Weight249.35 g/mol
Exact Mass249.17
IUPAC Name4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid
SMILESCCc1ccc(N(C)CCC(C)(C)C(=O)O)cc1
InChIInChI=1S/C15H23NO2/c1-5-12-6-8-13(9-7-12)16(4)11-10-15(2,3)14(17)18/h6-9H,5,10-11H2,1-4H3,(H,17,18)
InChIKeyKDAQCFUGHXEQHN-UHFFFAOYSA-N
XLogP3.19
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.35
LogP ≤ 53.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}

Analyze 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid?
The IUPAC name of 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid (CID 65248225) is 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid.
What is the SMILES notation for 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid?
The canonical SMILES for 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid is CCc1ccc(N(C)CCC(C)(C)C(=O)O)cc1.
What is the InChIKey of 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid?
The InChIKey is KDAQCFUGHXEQHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-5-12-6-8-13(9-7-12)16(4)11-10-15(2,3)14(17)18/h6-9H,5,10-11H2,1-4H3,(H,17,18).
What are the key properties of 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid?
4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid has a molecular weight of 249.35 g/mol, XLogP of 3.19, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-ethyl-N-methylanilino)-2,2-dimethylbutanoic acid is sourced from PubChem (CID 65248225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).