C15H18N4OS — CID 62003206
3-(3-methoxy-N-methylanilino)-5,6-dimethylpyridazine-4-carbothioamide (PubChem CID 62003206) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-(3-methoxy-N-methylanilino)-5,6-dimethylpyridazine-4-carbothioamide.
| Compound Name | 3-(3-methoxy-N-methylanilino)-5,6-dimethylpyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 62003206 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 3-(3-methoxy-N-methylanilino)-5,6-dimethylpyridazine-4-carbothioamide |
| SMILES | COc1cccc(N(C)c2nnc(C)c(C)c2C(N)=S)c1 |
| InChI | InChI=1S/C15H18N4OS/c1-9-10(2)17-18-15(13(9)14(16)21)19(3)11-6-5-7-12(8-11)20-4/h5-8H,1-4H3,(H2,16,21) |
| InChIKey | BGPZWEVEOLGLFY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|