C18H15NO6S — CID 6200726
(5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-(3-hydroxyphenyl)-1,3-thiazolidine-2,4-dione (PubChem CID 6200726) has the molecular formula C18H15NO6S and a molecular weight of 373.39 g/mol. Its IUPAC name is (5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-(3-hydroxyphenyl)-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-(3-hydroxyphenyl)-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 6200726 |
| Molecular Formula | C18H15NO6S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | (5Z)-5-[(4-hydroxy-3,5-dimethoxyphenyl)methylidene]-3-(3-hydroxyphenyl)-1,3-thiazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2\SC(=O)N(c3cccc(O)c3)C2=O)cc(OC)c1O |
| InChI | InChI=1S/C18H15NO6S/c1-24-13-6-10(7-14(25-2)16(13)21)8-15-17(22)19(18(23)26-15)11-4-3-5-12(20)9-11/h3-9,20-21H,1-2H3/b15-8- |
| InChIKey | QIBCECGIZCETET-NVNXTCNLSA-N |
| XLogP | 3.36 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|