C12H27N3O2S — CID 62007444
N-(1-amino-2-methylpropan-2-yl)-N-ethyl-2-methylpiperidine-1-sulfonamide (PubChem CID 62007444) has the molecular formula C12H27N3O2S and a molecular weight of 277.43 g/mol. Its IUPAC name is N-(1-amino-2-methylpropan-2-yl)-N-ethyl-2-methylpiperidine-1-sulfonamide.
| Compound Name | N-(1-amino-2-methylpropan-2-yl)-N-ethyl-2-methylpiperidine-1-sulfonamide |
|---|---|
| PubChem CID | 62007444 |
| Molecular Formula | C12H27N3O2S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | N-(1-amino-2-methylpropan-2-yl)-N-ethyl-2-methylpiperidine-1-sulfonamide |
| SMILES | CCN(C(C)(C)CN)S(=O)(=O)N1CCCCC1C |
| InChI | InChI=1S/C12H27N3O2S/c1-5-15(12(3,4)10-13)18(16,17)14-9-7-6-8-11(14)2/h11H,5-10,13H2,1-4H3 |
| InChIKey | JXUBZSVIGZMSRG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |