C16H14Cl2N2O — CID 62008465
2-(3,5-dichlorophenyl)-7,7-dimethyl-6,8-dihydroquinazolin-5-one (PubChem CID 62008465) has the molecular formula C16H14Cl2N2O and a molecular weight of 321.21 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-7,7-dimethyl-6,8-dihydroquinazolin-5-one.
| Compound Name | 2-(3,5-dichlorophenyl)-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
|---|---|
| PubChem CID | 62008465 |
| Molecular Formula | C16H14Cl2N2O |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-7,7-dimethyl-6,8-dihydroquinazolin-5-one |
| SMILES | CC1(C)CC(=O)c2cnc(-c3cc(Cl)cc(Cl)c3)nc2C1 |
| InChI | InChI=1S/C16H14Cl2N2O/c1-16(2)6-13-12(14(21)7-16)8-19-15(20-13)9-3-10(17)5-11(18)4-9/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | OIJHTDNCZMJPSX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |