C10H25N3O2S — CID 62010048
2-N-(diethylsulfamoyl)-2-N,2-dimethylbutane-1,2-diamine (PubChem CID 62010048) has the molecular formula C10H25N3O2S and a molecular weight of 251.40 g/mol. Its IUPAC name is 2-N-(diethylsulfamoyl)-2-N,2-dimethylbutane-1,2-diamine.
| Compound Name | 2-N-(diethylsulfamoyl)-2-N,2-dimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 62010048 |
| Molecular Formula | C10H25N3O2S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2-N-(diethylsulfamoyl)-2-N,2-dimethylbutane-1,2-diamine |
| SMILES | CCN(CC)S(=O)(=O)N(C)C(C)(CC)CN |
| InChI | InChI=1S/C10H25N3O2S/c1-6-10(4,9-11)12(5)16(14,15)13(7-2)8-3/h6-9,11H2,1-5H3 |
| InChIKey | ABTPCWNBLYVMPF-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |