C13H19NO5 — CID 62011256
methyl 3-[[(3-ethoxy-3-oxopropyl)-methylamino]methyl]furan-2-carboxylate (PubChem CID 62011256) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is methyl 3-[[(3-ethoxy-3-oxopropyl)-methylamino]methyl]furan-2-carboxylate.
| Compound Name | methyl 3-[[(3-ethoxy-3-oxopropyl)-methylamino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 62011256 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | methyl 3-[[(3-ethoxy-3-oxopropyl)-methylamino]methyl]furan-2-carboxylate |
| SMILES | CCOC(=O)CCN(C)Cc1ccoc1C(=O)OC |
| InChI | InChI=1S/C13H19NO5/c1-4-18-11(15)5-7-14(2)9-10-6-8-19-12(10)13(16)17-3/h6,8H,4-5,7,9H2,1-3H3 |
| InChIKey | ORTWYBGLCDHWFK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |