C16H23NO4 — CID 62012473
methyl 3-[(5-acetyl-2-ethoxyphenyl)methyl-methylamino]propanoate (PubChem CID 62012473) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is methyl 3-[(5-acetyl-2-ethoxyphenyl)methyl-methylamino]propanoate.
| Compound Name | methyl 3-[(5-acetyl-2-ethoxyphenyl)methyl-methylamino]propanoate |
|---|---|
| PubChem CID | 62012473 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | methyl 3-[(5-acetyl-2-ethoxyphenyl)methyl-methylamino]propanoate |
| SMILES | CCOc1ccc(C(C)=O)cc1CN(C)CCC(=O)OC |
| InChI | InChI=1S/C16H23NO4/c1-5-21-15-7-6-13(12(2)18)10-14(15)11-17(3)9-8-16(19)20-4/h6-7,10H,5,8-9,11H2,1-4H3 |
| InChIKey | RLOOLWIPSUPTQK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |