C20H22F3NO3 — CID 112812859
1-[4-ethoxy-3-[[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]methyl]phenyl]ethanone (PubChem CID 112812859) has the molecular formula C20H22F3NO3 and a molecular weight of 381.39 g/mol. Its IUPAC name is 1-[4-ethoxy-3-[[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]methyl]phenyl]ethanone.
| Compound Name | 1-[4-ethoxy-3-[[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]methyl]phenyl]ethanone |
|---|---|
| PubChem CID | 112812859 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 1-[4-ethoxy-3-[[methyl-[[2-(trifluoromethoxy)phenyl]methyl]amino]methyl]phenyl]ethanone |
| SMILES | CCOc1ccc(C(C)=O)cc1CN(C)Cc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C20H22F3NO3/c1-4-26-18-10-9-15(14(2)25)11-17(18)13-24(3)12-16-7-5-6-8-19(16)27-20(21,22)23/h5-11H,4,12-13H2,1-3H3 |
| InChIKey | CIRNHRLVDSJMNI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |