C12H17NO5 — CID 62012517
methyl 4-[(5-hydroxy-4-oxopyran-2-yl)methyl-methylamino]butanoate (PubChem CID 62012517) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl 4-[(5-hydroxy-4-oxopyran-2-yl)methyl-methylamino]butanoate.
| Compound Name | methyl 4-[(5-hydroxy-4-oxopyran-2-yl)methyl-methylamino]butanoate |
|---|---|
| PubChem CID | 62012517 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | methyl 4-[(5-hydroxy-4-oxopyran-2-yl)methyl-methylamino]butanoate |
| SMILES | COC(=O)CCCN(C)Cc1cc(=O)c(O)co1 |
| InChI | InChI=1S/C12H17NO5/c1-13(5-3-4-12(16)17-2)7-9-6-10(14)11(15)8-18-9/h6,8,15H,3-5,7H2,1-2H3 |
| InChIKey | SRRAOZHBKMBRPJ-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |