C14H19NO5 — CID 80708462
methyl 2-[cyclopentyl-[(5-hydroxy-4-oxopyran-2-yl)methyl]amino]acetate (PubChem CID 80708462) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is methyl 2-[cyclopentyl-[(5-hydroxy-4-oxopyran-2-yl)methyl]amino]acetate.
| Compound Name | methyl 2-[cyclopentyl-[(5-hydroxy-4-oxopyran-2-yl)methyl]amino]acetate |
|---|---|
| PubChem CID | 80708462 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | methyl 2-[cyclopentyl-[(5-hydroxy-4-oxopyran-2-yl)methyl]amino]acetate |
| SMILES | COC(=O)CN(Cc1cc(=O)c(O)co1)C1CCCC1 |
| InChI | InChI=1S/C14H19NO5/c1-19-14(18)8-15(10-4-2-3-5-10)7-11-6-12(16)13(17)9-20-11/h6,9-10,17H,2-5,7-8H2,1H3 |
| InChIKey | NBZDRVIYGNABDG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |