methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate

C12H23NO3 — CID 62013260

IUPACmethyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate
SMILESCOC(=O)CCCN(C)C1CCCCC1O
InChIInChI=1S/C12H23NO3/c1-13(9-5-8-12(15)16-2)10-6-3-4-7-11(10)14/h10-11,14H,3-9H2,1-2H3
InChIKeyFMLPQXCAGFAPBC-UHFFFAOYSA-N
MW229.32 g/mol
LogP1.17
Rot. Bonds5

About methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate

methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate (PubChem CID 62013260) has the molecular formula C12H23NO3 and a molecular weight of 229.32 g/mol. Its IUPAC name is methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate.

Molecular Properties

Compound Namemethyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate
PubChem CID62013260
Molecular FormulaC12H23NO3
Molecular Weight229.32 g/mol
Exact Mass229.17
IUPAC Namemethyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate
SMILESCOC(=O)CCCN(C)C1CCCCC1O
InChIInChI=1S/C12H23NO3/c1-13(9-5-8-12(15)16-2)10-6-3-4-7-11(10)14/h10-11,14H,3-9H2,1-2H3
InChIKeyFMLPQXCAGFAPBC-UHFFFAOYSA-N
XLogP1.17
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.32
LogP ≤ 51.17
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate?
The IUPAC name of methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate (CID 62013260) is methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate.
What is the SMILES notation for methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate?
The canonical SMILES for methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate is COC(=O)CCCN(C)C1CCCCC1O.
What is the InChIKey of methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate?
The InChIKey is FMLPQXCAGFAPBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO3/c1-13(9-5-8-12(15)16-2)10-6-3-4-7-11(10)14/h10-11,14H,3-9H2,1-2H3.
What are the key properties of methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate?
methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate has a molecular weight of 229.32 g/mol, XLogP of 1.17, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[(2-hydroxycyclohexyl)-methylamino]butanoate is sourced from PubChem (CID 62013260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).