C10H21NO2 — CID 102734703
trans-(1R,2R)-2-[3-methoxypropyl(methyl)amino]cyclopentan-1-ol (PubChem CID 102734703) has the molecular formula C10H21NO2 and a molecular weight of 187.28 g/mol. Its IUPAC name is trans-(1R,2R)-2-[3-methoxypropyl(methyl)amino]cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-[3-methoxypropyl(methyl)amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 102734703 |
| Molecular Formula | C10H21NO2 |
| Molecular Weight | 187.28 g/mol |
| Exact Mass | 187.16 |
| IUPAC Name | trans-(1R,2R)-2-[3-methoxypropyl(methyl)amino]cyclopentan-1-ol |
| SMILES | COCCCN(C)[C@@H]1CCC[C@H]1O |
| InChI | InChI=1S/C10H21NO2/c1-11(7-4-8-13-2)9-5-3-6-10(9)12/h9-10,12H,3-8H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | PBTMZOOSOAVXIM-NXEZZACHSA-N |
| XLogP | 0.87 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|