C17H36N2O — CID 63468227
2-N-(3-methoxypropyl)-2-N-methylcyclododecane-1,2-diamine (PubChem CID 63468227) has the molecular formula C17H36N2O and a molecular weight of 284.49 g/mol. Its IUPAC name is 2-N-(3-methoxypropyl)-2-N-methylcyclododecane-1,2-diamine.
| Compound Name | 2-N-(3-methoxypropyl)-2-N-methylcyclododecane-1,2-diamine |
|---|---|
| PubChem CID | 63468227 |
| Molecular Formula | C17H36N2O |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | 2-N-(3-methoxypropyl)-2-N-methylcyclododecane-1,2-diamine |
| SMILES | COCCCN(C)C1CCCCCCCCCCC1N |
| InChI | InChI=1S/C17H36N2O/c1-19(14-11-15-20-2)17-13-10-8-6-4-3-5-7-9-12-16(17)18/h16-17H,3-15,18H2,1-2H3 |
| InChIKey | VJVPZPPXYPZRBM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|