C13H16N4O3 — CID 62013767
[1-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methyl]pyrrolidin-2-yl]methanol (PubChem CID 62013767) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is [1-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methyl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 62013767 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | [1-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methyl]pyrrolidin-2-yl]methanol |
| SMILES | O=[N+]([O-])c1c(CN2CCCC2CO)nc2ccccn12 |
| InChI | InChI=1S/C13H16N4O3/c18-9-10-4-3-6-15(10)8-11-13(17(19)20)16-7-2-1-5-12(16)14-11/h1-2,5,7,10,18H,3-4,6,8-9H2 |
| InChIKey | JAEXWTDEZKZRKK-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|