C10H9N7O2 — CID 79542495
1-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methyl]triazol-4-amine (PubChem CID 79542495) has the molecular formula C10H9N7O2 and a molecular weight of 259.23 g/mol. Its IUPAC name is 1-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methyl]triazol-4-amine.
| Compound Name | 1-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methyl]triazol-4-amine |
|---|---|
| PubChem CID | 79542495 |
| Molecular Formula | C10H9N7O2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1-[(3-nitroimidazo[1,2-a]pyridin-2-yl)methyl]triazol-4-amine |
| SMILES | Nc1cn(Cc2nc3ccccn3c2[N+](=O)[O-])nn1 |
| InChI | InChI=1S/C10H9N7O2/c11-8-6-15(14-13-8)5-7-10(17(18)19)16-4-2-1-3-9(16)12-7/h1-4,6H,5,11H2 |
| InChIKey | GXHFZJBOGWWRGF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|