About N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine
N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine (PubChem CID 18095071) has the molecular formula C15H14N4O4
and a molecular weight of 314.30 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine.
Molecular Properties
| Compound Name | N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine |
| PubChem CID | 18095071 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine |
| SMILES | COc1cc(Nc2nc3ccccn3c2[N+](=O)[O-])cc(OC)c1 |
| InChI | InChI=1S/C15H14N4O4/c1-22-11-7-10(8-12(9-11)23-2)16-14-15(19(20)21)18-6-4-3-5-13(18)17-14/h3-9,16H,1-2H3 |
| InChIKey | LNWJEXCIWYWEEE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine?
The IUPAC name of N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine (CID 18095071) is N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine.
What is the SMILES notation for N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine?
The canonical SMILES for N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine is COc1cc(Nc2nc3ccccn3c2[N+](=O)[O-])cc(OC)c1.
What is the InChIKey of N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine?
The InChIKey is LNWJEXCIWYWEEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O4/c1-22-11-7-10(8-12(9-11)23-2)16-14-15(19(20)21)18-6-4-3-5-13(18)17-14/h3-9,16H,1-2H3.
What are the key properties of N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine?
N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine has a molecular weight of 314.30 g/mol, XLogP of 3.00, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine is sourced from PubChem (CID 18095071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).