C15H14N4O4 — CID 18095071
N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine (PubChem CID 18095071) has the molecular formula C15H14N4O4 and a molecular weight of 314.30 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 18095071 |
| Molecular Formula | C15H14N4O4 |
| Molecular Weight | 314.30 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-3-nitroimidazo[1,2-a]pyridin-2-amine |
| SMILES | COc1cc(Nc2nc3ccccn3c2[N+](=O)[O-])cc(OC)c1 |
| InChI | InChI=1S/C15H14N4O4/c1-22-11-7-10(8-12(9-11)23-2)16-14-15(19(20)21)18-6-4-3-5-13(18)17-14/h3-9,16H,1-2H3 |
| InChIKey | LNWJEXCIWYWEEE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|