C16H13F3N4O2 — CID 42886696
3-nitro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]imidazo[1,2-a]pyridin-2-amine (PubChem CID 42886696) has the molecular formula C16H13F3N4O2 and a molecular weight of 350.30 g/mol. Its IUPAC name is 3-nitro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]imidazo[1,2-a]pyridin-2-amine.
| Compound Name | 3-nitro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]imidazo[1,2-a]pyridin-2-amine |
|---|---|
| PubChem CID | 42886696 |
| Molecular Formula | C16H13F3N4O2 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 3-nitro-N-[1-[3-(trifluoromethyl)phenyl]ethyl]imidazo[1,2-a]pyridin-2-amine |
| SMILES | CC(Nc1nc2ccccn2c1[N+](=O)[O-])c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H13F3N4O2/c1-10(11-5-4-6-12(9-11)16(17,18)19)20-14-15(23(24)25)22-8-3-2-7-13(22)21-14/h2-10,20H,1H3 |
| InChIKey | CRRQESODQUEYKL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|