C9H6N6O2S — CID 71388944
5-(3-nitroimidazo[1,2-a]pyridin-2-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 71388944) has the molecular formula C9H6N6O2S and a molecular weight of 262.25 g/mol. Its IUPAC name is 5-(3-nitroimidazo[1,2-a]pyridin-2-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3-nitroimidazo[1,2-a]pyridin-2-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 71388944 |
| Molecular Formula | C9H6N6O2S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 5-(3-nitroimidazo[1,2-a]pyridin-2-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-c2nc3ccccn3c2[N+](=O)[O-])s1 |
| InChI | InChI=1S/C9H6N6O2S/c10-9-13-12-7(18-9)6-8(15(16)17)14-4-2-1-3-5(14)11-6/h1-4H,(H2,10,13) |
| InChIKey | VWIOGVHDAWOODV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|