C14H18F3NOS — CID 62015724
[1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]pyrrolidin-2-yl]methanol (PubChem CID 62015724) has the molecular formula C14H18F3NOS and a molecular weight of 305.37 g/mol. Its IUPAC name is [1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 62015724 |
| Molecular Formula | C14H18F3NOS |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | [1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]pyrrolidin-2-yl]methanol |
| SMILES | OCC1CCCN1CCSc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NOS/c15-14(16,17)11-3-1-5-13(9-11)20-8-7-18-6-2-4-12(18)10-19/h1,3,5,9,12,19H,2,4,6-8,10H2 |
| InChIKey | FGICTVFPPXUZPK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |