C12H14F3NOS — CID 63282006
1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]azetidin-3-ol (PubChem CID 63282006) has the molecular formula C12H14F3NOS and a molecular weight of 277.31 g/mol. Its IUPAC name is 1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]azetidin-3-ol.
| Compound Name | 1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]azetidin-3-ol |
|---|---|
| PubChem CID | 63282006 |
| Molecular Formula | C12H14F3NOS |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 1-[2-[3-(trifluoromethyl)phenyl]sulfanylethyl]azetidin-3-ol |
| SMILES | OC1CN(CCSc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C12H14F3NOS/c13-12(14,15)9-2-1-3-11(6-9)18-5-4-16-7-10(17)8-16/h1-3,6,10,17H,4-5,7-8H2 |
| InChIKey | FZKLSNOTIVDWAA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |