C14H21ClFNO — CID 62016261
2-[(2-chloro-6-fluorophenyl)methyl-pentan-3-ylamino]ethanol (PubChem CID 62016261) has the molecular formula C14H21ClFNO and a molecular weight of 273.78 g/mol. Its IUPAC name is 2-[(2-chloro-6-fluorophenyl)methyl-pentan-3-ylamino]ethanol.
| Compound Name | 2-[(2-chloro-6-fluorophenyl)methyl-pentan-3-ylamino]ethanol |
|---|---|
| PubChem CID | 62016261 |
| Molecular Formula | C14H21ClFNO |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 2-[(2-chloro-6-fluorophenyl)methyl-pentan-3-ylamino]ethanol |
| SMILES | CCC(CC)N(CCO)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C14H21ClFNO/c1-3-11(4-2)17(8-9-18)10-12-13(15)6-5-7-14(12)16/h5-7,11,18H,3-4,8-10H2,1-2H3 |
| InChIKey | MEEKFAZIYDZIHP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |