C15H21N3O3 — CID 62019037
3-propyl-5-(2,3,4-trimethoxyphenyl)imidazol-4-amine (PubChem CID 62019037) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 3-propyl-5-(2,3,4-trimethoxyphenyl)imidazol-4-amine.
| Compound Name | 3-propyl-5-(2,3,4-trimethoxyphenyl)imidazol-4-amine |
|---|---|
| PubChem CID | 62019037 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 3-propyl-5-(2,3,4-trimethoxyphenyl)imidazol-4-amine |
| SMILES | CCCn1cnc(-c2ccc(OC)c(OC)c2OC)c1N |
| InChI | InChI=1S/C15H21N3O3/c1-5-8-18-9-17-12(15(18)16)10-6-7-11(19-2)14(21-4)13(10)20-3/h6-7,9H,5,8,16H2,1-4H3 |
| InChIKey | KTKZKEXZWATCEA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |