C13H15N3O4S — CID 62020689
N-(2-cyanoethyl)-N-cyclopropyl-1-(2-nitrophenyl)methanesulfonamide (PubChem CID 62020689) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is N-(2-cyanoethyl)-N-cyclopropyl-1-(2-nitrophenyl)methanesulfonamide.
| Compound Name | N-(2-cyanoethyl)-N-cyclopropyl-1-(2-nitrophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 62020689 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-(2-cyanoethyl)-N-cyclopropyl-1-(2-nitrophenyl)methanesulfonamide |
| SMILES | N#CCCN(C1CC1)S(=O)(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H15N3O4S/c14-8-3-9-15(12-6-7-12)21(19,20)10-11-4-1-2-5-13(11)16(17)18/h1-2,4-5,12H,3,6-7,9-10H2 |
| InChIKey | GOFIRGNRZLTKLI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 104.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|