C12H15NO3S — CID 62023614
1-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-phenylpropan-2-one (PubChem CID 62023614) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-phenylpropan-2-one.
| Compound Name | 1-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-phenylpropan-2-one |
|---|---|
| PubChem CID | 62023614 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 1-(1,1-dioxo-1,2-thiazolidin-2-yl)-3-phenylpropan-2-one |
| SMILES | O=C(Cc1ccccc1)CN1CCCS1(=O)=O |
| InChI | InChI=1S/C12H15NO3S/c14-12(9-11-5-2-1-3-6-11)10-13-7-4-8-17(13,15)16/h1-3,5-6H,4,7-10H2 |
| InChIKey | RLVVJKRSNYQCKB-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |