C16H11Cl2NO2 — CID 62024728
2-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3H-isoindol-1-one (PubChem CID 62024728) has the molecular formula C16H11Cl2NO2 and a molecular weight of 320.18 g/mol. Its IUPAC name is 2-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3H-isoindol-1-one.
| Compound Name | 2-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3H-isoindol-1-one |
|---|---|
| PubChem CID | 62024728 |
| Molecular Formula | C16H11Cl2NO2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 2-[2-(2,4-dichlorophenyl)-2-oxoethyl]-3H-isoindol-1-one |
| SMILES | O=C(CN1Cc2ccccc2C1=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl2NO2/c17-11-5-6-13(14(18)7-11)15(20)9-19-8-10-3-1-2-4-12(10)16(19)21/h1-7H,8-9H2 |
| InChIKey | IUCYBGMEXZLNDS-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |