C13H19N3O4 — CID 62026376
ethyl 2-[ethyl-[2-oxo-2-(1H-pyrrole-2-carbonylamino)ethyl]amino]acetate (PubChem CID 62026376) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is ethyl 2-[ethyl-[2-oxo-2-(1H-pyrrole-2-carbonylamino)ethyl]amino]acetate.
| Compound Name | ethyl 2-[ethyl-[2-oxo-2-(1H-pyrrole-2-carbonylamino)ethyl]amino]acetate |
|---|---|
| PubChem CID | 62026376 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | ethyl 2-[ethyl-[2-oxo-2-(1H-pyrrole-2-carbonylamino)ethyl]amino]acetate |
| SMILES | CCOC(=O)CN(CC)CC(=O)NC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C13H19N3O4/c1-3-16(9-12(18)20-4-2)8-11(17)15-13(19)10-6-5-7-14-10/h5-7,14H,3-4,8-9H2,1-2H3,(H,15,17,19) |
| InChIKey | WBIUXLARYUBRCB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |