C12H17N3O4S — CID 106443011
(2S)-2-amino-3-methyl-3-[2-oxo-2-(1H-pyrrole-2-carbonylamino)ethyl]sulfanylbutanoic acid (PubChem CID 106443011) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is (2S)-2-amino-3-methyl-3-[2-oxo-2-(1H-pyrrole-2-carbonylamino)ethyl]sulfanylbutanoic acid.
| Compound Name | (2S)-2-amino-3-methyl-3-[2-oxo-2-(1H-pyrrole-2-carbonylamino)ethyl]sulfanylbutanoic acid |
|---|---|
| PubChem CID | 106443011 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (2S)-2-amino-3-methyl-3-[2-oxo-2-(1H-pyrrole-2-carbonylamino)ethyl]sulfanylbutanoic acid |
| SMILES | CC(C)(SCC(=O)NC(=O)c1ccc[nH]1)[C@@H](N)C(=O)O |
| InChI | InChI=1S/C12H17N3O4S/c1-12(2,9(13)11(18)19)20-6-8(16)15-10(17)7-4-3-5-14-7/h3-5,9,14H,6,13H2,1-2H3,(H,18,19)(H,15,16,17)/t9-/m0/s1 |
| InChIKey | XEGDNVXOEJWOTO-VIFPVBQESA-N |
| XLogP | 0.19 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |