C9H12N2O3S — CID 43502574
N-[2-(2-hydroxyethylsulfanyl)acetyl]-1H-pyrrole-2-carboxamide (PubChem CID 43502574) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is N-[2-(2-hydroxyethylsulfanyl)acetyl]-1H-pyrrole-2-carboxamide.
| Compound Name | N-[2-(2-hydroxyethylsulfanyl)acetyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43502574 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | N-[2-(2-hydroxyethylsulfanyl)acetyl]-1H-pyrrole-2-carboxamide |
| SMILES | O=C(CSCCO)NC(=O)c1ccc[nH]1 |
| InChI | InChI=1S/C9H12N2O3S/c12-4-5-15-6-8(13)11-9(14)7-2-1-3-10-7/h1-3,10,12H,4-6H2,(H,11,13,14) |
| InChIKey | ANEBEQIIYFQBOR-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|