C14H20N2O4 — CID 62026904
methyl 1-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate (PubChem CID 62026904) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 1-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 62026904 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | methyl 1-[1-(furan-2-ylmethylamino)-1-oxopropan-2-yl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1C(C)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H20N2O4/c1-10(13(17)15-9-11-5-4-8-20-11)16-7-3-6-12(16)14(18)19-2/h4-5,8,10,12H,3,6-7,9H2,1-2H3,(H,15,17) |
| InChIKey | VTVPRSNYLPXVTF-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |