C16H22N4O2 — CID 95611636
(2R)-N-(furan-2-ylmethyl)-2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]propanamide (PubChem CID 95611636) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is (2R)-N-(furan-2-ylmethyl)-2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]propanamide.
| Compound Name | (2R)-N-(furan-2-ylmethyl)-2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]propanamide |
|---|---|
| PubChem CID | 95611636 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | (2R)-N-(furan-2-ylmethyl)-2-[(2R)-2-(pyrazol-1-ylmethyl)pyrrolidin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NCc1ccco1)N1CCC[C@@H]1Cn1cccn1 |
| InChI | InChI=1S/C16H22N4O2/c1-13(16(21)17-11-15-6-3-10-22-15)20-9-2-5-14(20)12-19-8-4-7-18-19/h3-4,6-8,10,13-14H,2,5,9,11-12H2,1H3,(H,17,21)/t13-,14-/m1/s1 |
| InChIKey | TXTCSAGYDHUVHM-ZIAGYGMSSA-N |
| XLogP | 1.65 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |