C10H15N3O3 — CID 62027282
methyl 1-[2-(cyanomethylamino)-2-oxoethyl]pyrrolidine-2-carboxylate (PubChem CID 62027282) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is methyl 1-[2-(cyanomethylamino)-2-oxoethyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[2-(cyanomethylamino)-2-oxoethyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 62027282 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | methyl 1-[2-(cyanomethylamino)-2-oxoethyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1CC(=O)NCC#N |
| InChI | InChI=1S/C10H15N3O3/c1-16-10(15)8-3-2-6-13(8)7-9(14)12-5-4-11/h8H,2-3,5-7H2,1H3,(H,12,14) |
| InChIKey | OVTIUNJEXTXUQL-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|