C15H11Cl2FO2 — CID 62028936
3-(2,5-dichlorophenoxy)-1-(4-fluorophenyl)propan-1-one (PubChem CID 62028936) has the molecular formula C15H11Cl2FO2 and a molecular weight of 313.16 g/mol. Its IUPAC name is 3-(2,5-dichlorophenoxy)-1-(4-fluorophenyl)propan-1-one.
| Compound Name | 3-(2,5-dichlorophenoxy)-1-(4-fluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 62028936 |
| Molecular Formula | C15H11Cl2FO2 |
| Molecular Weight | 313.16 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 3-(2,5-dichlorophenoxy)-1-(4-fluorophenyl)propan-1-one |
| SMILES | O=C(CCOc1cc(Cl)ccc1Cl)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H11Cl2FO2/c16-11-3-6-13(17)15(9-11)20-8-7-14(19)10-1-4-12(18)5-2-10/h1-6,9H,7-8H2 |
| InChIKey | XDAMBZIUILFFEZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.16 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |